C26H26N4O4 — CID 167740197
2-(2,6-dioxopiperidin-3-yl)-4-(spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylmethyl)isoindole-1,3-dione (PubChem CID 167740197) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylmethyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167740197 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CN4CCC5(CC4)CNc4ccccc45)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H26N4O4/c31-21-9-8-20(23(32)28-21)30-24(33)17-5-3-4-16(22(17)25(30)34)14-29-12-10-26(11-13-29)15-27-19-7-2-1-6-18(19)26/h1-7,20,27H,8-15H2,(H,28,31,32) |
| InChIKey | XQEDCDXMCDMMPK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|