C8H13N3O — CID 167740386
2-(2,5-dimethylpyrrol-1-yl)-N'-hydroxyethanimidamide (PubChem CID 167740386) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 167740386 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-N'-hydroxyethanimidamide |
| SMILES | Cc1ccc(C)n1C/C(N)=N/O |
| InChI | InChI=1S/C8H13N3O/c1-6-3-4-7(2)11(6)5-8(9)10-12/h3-4,12H,5H2,1-2H3,(H2,9,10) |
| InChIKey | LIHWJOHJBHKRRR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 63.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|