C14H21BF3N4O2- — CID 167740695
trifluoro-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]pyrimidin-5-yl]boranuide (PubChem CID 167740695) has the molecular formula C14H21BF3N4O2- and a molecular weight of 345.15 g/mol. Its IUPAC name is trifluoro-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]pyrimidin-5-yl]boranuide.
| Compound Name | trifluoro-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]pyrimidin-5-yl]boranuide |
|---|---|
| PubChem CID | 167740695 |
| Molecular Formula | C14H21BF3N4O2- |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | trifluoro-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]pyrimidin-5-yl]boranuide |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ncc([B-](F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C14H21BF3N4O2/c1-14(2,3)24-13(23)21-11-4-6-22(7-5-11)12-19-8-10(9-20-12)15(16,17)18/h8-9,11H,4-7H2,1-3H3,(H,21,23)/q-1 |
| InChIKey | UYKZAGRECHFDGP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|