C10H14BF3N2O2 — CID 167741189
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trifluoromethyl)imidazole (PubChem CID 167741189) has the molecular formula C10H14BF3N2O2 and a molecular weight of 262.04 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trifluoromethyl)imidazole.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 167741189 |
| Molecular Formula | C10H14BF3N2O2 |
| Molecular Weight | 262.04 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trifluoromethyl)imidazole |
| SMILES | CC1(C)OB(c2cn(C(F)(F)F)cn2)OC1(C)C |
| InChI | InChI=1S/C10H14BF3N2O2/c1-8(2)9(3,4)18-11(17-8)7-5-16(6-15-7)10(12,13)14/h5-6H,1-4H3 |
| InChIKey | REWRPUSPKOKCFX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|