C13H17N3O2S — CID 167743668
1-(1H-imidazol-5-yl)-N-[(3-methylsulfonylphenyl)methyl]ethanamine (PubChem CID 167743668) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)-N-[(3-methylsulfonylphenyl)methyl]ethanamine.
| Compound Name | 1-(1H-imidazol-5-yl)-N-[(3-methylsulfonylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 167743668 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(1H-imidazol-5-yl)-N-[(3-methylsulfonylphenyl)methyl]ethanamine |
| SMILES | CC(NCc1cccc(S(C)(=O)=O)c1)c1cnc[nH]1 |
| InChI | InChI=1S/C13H17N3O2S/c1-10(13-8-14-9-16-13)15-7-11-4-3-5-12(6-11)19(2,17)18/h3-6,8-10,15H,7H2,1-2H3,(H,14,16) |
| InChIKey | DJMOPSZGKDTVTD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |