C12H21N3O2S — CID 114141820
N',N'-dimethyl-3-[(propan-2-ylamino)methyl]benzenesulfonohydrazide (PubChem CID 114141820) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is N',N'-dimethyl-3-[(propan-2-ylamino)methyl]benzenesulfonohydrazide.
| Compound Name | N',N'-dimethyl-3-[(propan-2-ylamino)methyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 114141820 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N',N'-dimethyl-3-[(propan-2-ylamino)methyl]benzenesulfonohydrazide |
| SMILES | CC(C)NCc1cccc(S(=O)(=O)NN(C)C)c1 |
| InChI | InChI=1S/C12H21N3O2S/c1-10(2)13-9-11-6-5-7-12(8-11)18(16,17)14-15(3)4/h5-8,10,13-14H,9H2,1-4H3 |
| InChIKey | GQIJACJSZTZUBK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|