C16H20N2O3 — CID 167743789
2-[2-(2-methoxyphenyl)ethyl]-5-(oxan-3-yl)-1,3,4-oxadiazole (PubChem CID 167743789) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)ethyl]-5-(oxan-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[2-(2-methoxyphenyl)ethyl]-5-(oxan-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 167743789 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)ethyl]-5-(oxan-3-yl)-1,3,4-oxadiazole |
| SMILES | COc1ccccc1CCc1nnc(C2CCCOC2)o1 |
| InChI | InChI=1S/C16H20N2O3/c1-19-14-7-3-2-5-12(14)8-9-15-17-18-16(21-15)13-6-4-10-20-11-13/h2-3,5,7,13H,4,6,8-11H2,1H3 |
| InChIKey | WDQRHVLAIJWYEU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |