C17H13Cl2N3O2 — CID 167744959
2-(3,5-dichlorophenyl)-2-hydroxy-N-(4-pyrazol-1-ylphenyl)acetamide (PubChem CID 167744959) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-2-hydroxy-N-(4-pyrazol-1-ylphenyl)acetamide.
| Compound Name | 2-(3,5-dichlorophenyl)-2-hydroxy-N-(4-pyrazol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 167744959 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-2-hydroxy-N-(4-pyrazol-1-ylphenyl)acetamide |
| SMILES | O=C(Nc1ccc(-n2cccn2)cc1)C(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2N3O2/c18-12-8-11(9-13(19)10-12)16(23)17(24)21-14-2-4-15(5-3-14)22-7-1-6-20-22/h1-10,16,23H,(H,21,24) |
| InChIKey | CQNGABVLLQFBDY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |