C18H26N4O3 — CID 167745162
N-[1-(2-bicyclo[2.2.1]heptanyl)propyl]-2,4-dioxo-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxamide (PubChem CID 167745162) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)propyl]-2,4-dioxo-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)propyl]-2,4-dioxo-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 167745162 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)propyl]-2,4-dioxo-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxamide |
| SMILES | CCC(NC(=O)N1CCc2c([nH]c(=O)[nH]c2=O)C1)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H26N4O3/c1-2-14(13-8-10-3-4-11(13)7-10)20-18(25)22-6-5-12-15(9-22)19-17(24)21-16(12)23/h10-11,13-14H,2-9H2,1H3,(H,20,25)(H2,19,21,23,24) |
| InChIKey | GDDFMXSEDAFGBP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |