C13H11Cl2N3O3S — CID 155959973
7-(2,5-dichloro-4-methylthiophene-3-carbonyl)-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione (PubChem CID 155959973) has the molecular formula C13H11Cl2N3O3S and a molecular weight of 360.22 g/mol. Its IUPAC name is 7-(2,5-dichloro-4-methylthiophene-3-carbonyl)-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 7-(2,5-dichloro-4-methylthiophene-3-carbonyl)-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155959973 |
| Molecular Formula | C13H11Cl2N3O3S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 7-(2,5-dichloro-4-methylthiophene-3-carbonyl)-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(Cl)sc(Cl)c1C(=O)N1CCc2c([nH]c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C13H11Cl2N3O3S/c1-5-8(10(15)22-9(5)14)12(20)18-3-2-6-7(4-18)16-13(21)17-11(6)19/h2-4H2,1H3,(H2,16,17,19,21) |
| InChIKey | ULFAUZHEBURGJA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |