C18H24F2N6O4 — CID 167915677
7-[2,2-difluoro-4-[4-(1-hydroxy-3-methylbutyl)triazol-1-yl]butanoyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione (PubChem CID 167915677) has the molecular formula C18H24F2N6O4 and a molecular weight of 426.42 g/mol. Its IUPAC name is 7-[2,2-difluoro-4-[4-(1-hydroxy-3-methylbutyl)triazol-1-yl]butanoyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 7-[2,2-difluoro-4-[4-(1-hydroxy-3-methylbutyl)triazol-1-yl]butanoyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 167915677 |
| Molecular Formula | C18H24F2N6O4 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 7-[2,2-difluoro-4-[4-(1-hydroxy-3-methylbutyl)triazol-1-yl]butanoyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-dione |
| SMILES | CC(C)CC(O)c1cn(CCC(F)(F)C(=O)N2CCc3c([nH]c(=O)[nH]c3=O)C2)nn1 |
| InChI | InChI=1S/C18H24F2N6O4/c1-10(2)7-14(27)13-9-26(24-23-13)6-4-18(19,20)16(29)25-5-3-11-12(8-25)21-17(30)22-15(11)28/h9-10,14,27H,3-8H2,1-2H3,(H2,21,22,28,30) |
| InChIKey | BOGWXMOCCXJHLW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |