C15H13F2N3O3 — CID 167749043
3-[[5-(difluoromethyl)-1,3-oxazol-4-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 167749043) has the molecular formula C15H13F2N3O3 and a molecular weight of 321.28 g/mol. Its IUPAC name is 3-[[5-(difluoromethyl)-1,3-oxazol-4-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[[5-(difluoromethyl)-1,3-oxazol-4-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167749043 |
| Molecular Formula | C15H13F2N3O3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 3-[[5-(difluoromethyl)-1,3-oxazol-4-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccccc2)NC(=O)N(Cc2ncoc2C(F)F)C1=O |
| InChI | InChI=1S/C15H13F2N3O3/c1-15(9-5-3-2-4-6-9)13(21)20(14(22)19-15)7-10-11(12(16)17)23-8-18-10/h2-6,8,12H,7H2,1H3,(H,19,22) |
| InChIKey | WWVCHIHURGOXBA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|