C13H22N2O4S — CID 167749339
1-[bis(prop-2-enyl)sulfamoyl]-3,3-dimethylpyrrolidine-2-carboxylic acid (PubChem CID 167749339) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-[bis(prop-2-enyl)sulfamoyl]-3,3-dimethylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-[bis(prop-2-enyl)sulfamoyl]-3,3-dimethylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 167749339 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[bis(prop-2-enyl)sulfamoyl]-3,3-dimethylpyrrolidine-2-carboxylic acid |
| SMILES | C=CCN(CC=C)S(=O)(=O)N1CCC(C)(C)C1C(=O)O |
| InChI | InChI=1S/C13H22N2O4S/c1-5-8-14(9-6-2)20(18,19)15-10-7-13(3,4)11(15)12(16)17/h5-6,11H,1-2,7-10H2,3-4H3,(H,16,17) |
| InChIKey | MZVAOJNRTITGQX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|