About 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide
4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide (PubChem CID 136512519) has the molecular formula C11H21N3O4S2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide |
| PubChem CID | 136512519 |
| Molecular Formula | C11H21N3O4S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H21N3O4S2/c1-4-6-13(7-5-2)20(17,18)14-10-8-12(9-11-14)19(3,15)16/h4-5H,1-2,6-11H2,3H3 |
| InChIKey | RUSGNOYZSKTVSZ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide?
The IUPAC name of 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide (CID 136512519) is 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide.
What is the SMILES notation for 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide?
The canonical SMILES for 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide is C=CCN(CC=C)S(=O)(=O)N1CCN(S(C)(=O)=O)CC1.
What is the InChIKey of 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide?
The InChIKey is RUSGNOYZSKTVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O4S2/c1-4-6-13(7-5-2)20(17,18)14-10-8-12(9-11-14)19(3,15)16/h4-5H,1-2,6-11H2,3H3.
What are the key properties of 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide?
4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide has a molecular weight of 323.44 g/mol, XLogP of -0.52, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfonyl-N,N-bis(prop-2-enyl)piperazine-1-sulfonamide is sourced from PubChem (CID 136512519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).