About ethenamine;1-methyl-4-methylsulfonylpiperazine
ethenamine;1-methyl-4-methylsulfonylpiperazine (PubChem CID 21311598) has the molecular formula C8H19N3O2S
and a molecular weight of 221.33 g/mol. Its IUPAC name is ethenamine;1-methyl-4-methylsulfonylpiperazine.
Molecular Properties
| Compound Name | ethenamine;1-methyl-4-methylsulfonylpiperazine |
| PubChem CID | 21311598 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | ethenamine;1-methyl-4-methylsulfonylpiperazine |
| SMILES | C=CN.CN1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C6H14N2O2S.C2H5N/c1-7-3-5-8(6-4-7)11(2,9)10;1-2-3/h3-6H2,1-2H3;2H,1,3H2 |
| InChIKey | LVXYPBIEHFEXAY-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethenamine;1-methyl-4-methylsulfonylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenamine;1-methyl-4-methylsulfonylpiperazine?
The IUPAC name of ethenamine;1-methyl-4-methylsulfonylpiperazine (CID 21311598) is ethenamine;1-methyl-4-methylsulfonylpiperazine.
What is the SMILES notation for ethenamine;1-methyl-4-methylsulfonylpiperazine?
The canonical SMILES for ethenamine;1-methyl-4-methylsulfonylpiperazine is C=CN.CN1CCN(S(C)(=O)=O)CC1.
What is the InChIKey of ethenamine;1-methyl-4-methylsulfonylpiperazine?
The InChIKey is LVXYPBIEHFEXAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2S.C2H5N/c1-7-3-5-8(6-4-7)11(2,9)10;1-2-3/h3-6H2,1-2H3;2H,1,3H2.
What are the key properties of ethenamine;1-methyl-4-methylsulfonylpiperazine?
ethenamine;1-methyl-4-methylsulfonylpiperazine has a molecular weight of 221.33 g/mol, XLogP of -0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenamine;1-methyl-4-methylsulfonylpiperazine is sourced from PubChem (CID 21311598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).