C14H23N5O3S — CID 108862126
(Z)-2-(4-methylpiperazine-1-carbonyl)-3-(4-methylsulfonylpiperazin-1-yl)prop-2-enenitrile (PubChem CID 108862126) has the molecular formula C14H23N5O3S and a molecular weight of 341.44 g/mol. Its IUPAC name is (Z)-2-(4-methylpiperazine-1-carbonyl)-3-(4-methylsulfonylpiperazin-1-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-methylpiperazine-1-carbonyl)-3-(4-methylsulfonylpiperazin-1-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108862126 |
| Molecular Formula | C14H23N5O3S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (Z)-2-(4-methylpiperazine-1-carbonyl)-3-(4-methylsulfonylpiperazin-1-yl)prop-2-enenitrile |
| SMILES | CN1CCN(C(=O)/C(C#N)=C\N2CCN(S(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C14H23N5O3S/c1-16-3-7-18(8-4-16)14(20)13(11-15)12-17-5-9-19(10-6-17)23(2,21)22/h12H,3-10H2,1-2H3/b13-12- |
| InChIKey | HWQSBTIBYVLRPY-SEYXRHQNSA-N |
| XLogP | -1.25 |
| TPSA | 87.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|