C9H18N2O2S — CID 145315592
7-methyl-2-methylsulfonyl-2,7-diazaspiro[3.5]nonane (PubChem CID 145315592) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 7-methyl-2-methylsulfonyl-2,7-diazaspiro[3.5]nonane.
| Compound Name | 7-methyl-2-methylsulfonyl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 145315592 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 7-methyl-2-methylsulfonyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CN1CCC2(CC1)CN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C9H18N2O2S/c1-10-5-3-9(4-6-10)7-11(8-9)14(2,12)13/h3-8H2,1-2H3 |
| InChIKey | HRCBHMSYIABKKQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |