C8H16N2O2S — CID 153061234
4-methyl-7-methylsulfonyl-4,7-diazaspiro[2.5]octane (PubChem CID 153061234) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is 4-methyl-7-methylsulfonyl-4,7-diazaspiro[2.5]octane.
| Compound Name | 4-methyl-7-methylsulfonyl-4,7-diazaspiro[2.5]octane |
|---|---|
| PubChem CID | 153061234 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-methyl-7-methylsulfonyl-4,7-diazaspiro[2.5]octane |
| SMILES | CN1CCN(S(C)(=O)=O)CC12CC2 |
| InChI | InChI=1S/C8H16N2O2S/c1-9-5-6-10(13(2,11)12)7-8(9)3-4-8/h3-7H2,1-2H3 |
| InChIKey | VJMGDXGCEQVTOI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |