C12H24N2O2S — CID 163234157
5-tert-butyl-8-methylsulfonyl-5,8-diazaspiro[3.5]nonane (PubChem CID 163234157) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 5-tert-butyl-8-methylsulfonyl-5,8-diazaspiro[3.5]nonane.
| Compound Name | 5-tert-butyl-8-methylsulfonyl-5,8-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 163234157 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 5-tert-butyl-8-methylsulfonyl-5,8-diazaspiro[3.5]nonane |
| SMILES | CC(C)(C)N1CCN(S(C)(=O)=O)CC12CCC2 |
| InChI | InChI=1S/C12H24N2O2S/c1-11(2,3)14-9-8-13(17(4,15)16)10-12(14)6-5-7-12/h5-10H2,1-4H3 |
| InChIKey | YAANUNDYOMLZFP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |