C7H12N2O3S — CID 152706612
6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde (PubChem CID 152706612) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde.
| Compound Name | 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde |
|---|---|
| PubChem CID | 152706612 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde |
| SMILES | CS(=O)(=O)N1CC2(CCN2C=O)C1 |
| InChI | InChI=1S/C7H12N2O3S/c1-13(11,12)9-4-7(5-9)2-3-8(7)6-10/h6H,2-5H2,1H3 |
| InChIKey | ZSRZVYHJLGZULK-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|