About 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde
6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde (PubChem CID 152706612) has the molecular formula C7H12N2O3S
and a molecular weight of 204.25 g/mol. Its IUPAC name is 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde |
| PubChem CID | 152706612 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde |
| SMILES | CS(=O)(=O)N1CC2(CCN2C=O)C1 |
| InChI | InChI=1S/C7H12N2O3S/c1-13(11,12)9-4-7(5-9)2-3-8(7)6-10/h6H,2-5H2,1H3 |
| InChIKey | ZSRZVYHJLGZULK-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde?
The IUPAC name of 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde (CID 152706612) is 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde.
What is the SMILES notation for 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde?
The canonical SMILES for 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde is CS(=O)(=O)N1CC2(CCN2C=O)C1.
What is the InChIKey of 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde?
The InChIKey is ZSRZVYHJLGZULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3S/c1-13(11,12)9-4-7(5-9)2-3-8(7)6-10/h6H,2-5H2,1H3.
What are the key properties of 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde?
6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde has a molecular weight of 204.25 g/mol, XLogP of -1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfonyl-1,6-diazaspiro[3.3]heptane-1-carbaldehyde is sourced from PubChem (CID 152706612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).