C13H27NO3S — CID 140924945
2,2-ditert-butyl-4-methylsulfonylmorpholine (PubChem CID 140924945) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is 2,2-ditert-butyl-4-methylsulfonylmorpholine.
| Compound Name | 2,2-ditert-butyl-4-methylsulfonylmorpholine |
|---|---|
| PubChem CID | 140924945 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2,2-ditert-butyl-4-methylsulfonylmorpholine |
| SMILES | CC(C)(C)C1(C(C)(C)C)CN(S(C)(=O)=O)CCO1 |
| InChI | InChI=1S/C13H27NO3S/c1-11(2,3)13(12(4,5)6)10-14(8-9-17-13)18(7,15)16/h8-10H2,1-7H3 |
| InChIKey | IUPAUYVVLXEMRR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |