C16H23N3O3S — CID 98789035
(6R)-4-(benzenesulfonyl)-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 98789035) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is (6R)-4-(benzenesulfonyl)-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | (6R)-4-(benzenesulfonyl)-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 98789035 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (6R)-4-(benzenesulfonyl)-1-methyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CN1CCN(S(=O)(=O)c2ccccc2)C[C@@]12CCNC(=O)CC2 |
| InChI | InChI=1S/C16H23N3O3S/c1-18-11-12-19(23(21,22)14-5-3-2-4-6-14)13-16(18)8-7-15(20)17-10-9-16/h2-6H,7-13H2,1H3,(H,17,20)/t16-/m1/s1 |
| InChIKey | FLIGRLRCNTUXJA-MRXNPFEDSA-N |
| XLogP | 0.66 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |