About imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane
imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane (PubChem CID 157041088) has the molecular formula C9H19N3OS
and a molecular weight of 217.34 g/mol. Its IUPAC name is imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane |
| PubChem CID | 157041088 |
| Molecular Formula | C9H19N3OS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)N1CC2(CCN(C)CC2)C1 |
| InChI | InChI=1S/C9H19N3OS/c1-11-5-3-9(4-6-11)7-12(8-9)14(2,10)13/h10H,3-8H2,1-2H3 |
| InChIKey | CVNJBKXFLORCDV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane?
The IUPAC name of imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane (CID 157041088) is imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane.
What is the SMILES notation for imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane?
The canonical SMILES for imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane is [H]N=S(C)(=O)N1CC2(CCN(C)CC2)C1.
What is the InChIKey of imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane?
The InChIKey is CVNJBKXFLORCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3OS/c1-11-5-3-9(4-6-11)7-12(8-9)14(2,10)13/h10H,3-8H2,1-2H3.
What are the key properties of imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane?
imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane has a molecular weight of 217.34 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imino-methyl-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-oxo-λ6-sulfane is sourced from PubChem (CID 157041088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).