C17H25NO4S — CID 167749491
2-[3-(3-tert-butylphenoxy)propyl]-1,1-dioxothiazinan-3-one (PubChem CID 167749491) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-[3-(3-tert-butylphenoxy)propyl]-1,1-dioxothiazinan-3-one.
| Compound Name | 2-[3-(3-tert-butylphenoxy)propyl]-1,1-dioxothiazinan-3-one |
|---|---|
| PubChem CID | 167749491 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[3-(3-tert-butylphenoxy)propyl]-1,1-dioxothiazinan-3-one |
| SMILES | CC(C)(C)c1cccc(OCCCN2C(=O)CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H25NO4S/c1-17(2,3)14-7-4-8-15(13-14)22-11-6-10-18-16(19)9-5-12-23(18,20)21/h4,7-8,13H,5-6,9-12H2,1-3H3 |
| InChIKey | YISWXBOPEZHWMF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|