C16H18Cl2N2O3 — CID 167749495
2-[(3aS,6aR)-3-oxo-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide (PubChem CID 167749495) has the molecular formula C16H18Cl2N2O3 and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-[(3aS,6aR)-3-oxo-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-[(3aS,6aR)-3-oxo-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 167749495 |
| Molecular Formula | C16H18Cl2N2O3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[(3aS,6aR)-3-oxo-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)CN1C[C@@H]2COC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C16H18Cl2N2O3/c1-19(5-10-2-3-13(17)14(18)4-10)15(21)8-20-6-11-9-23-16(22)12(11)7-20/h2-4,11-12H,5-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | GTLMMFCNEDIUNP-VXGBXAGGSA-N |
| XLogP | 2.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |