About butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate
butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate (PubChem CID 167752619) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate.
Analyze butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate?
The IUPAC name of butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate (CID 167752619) is butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate.
What is the SMILES notation for butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate?
The canonical SMILES for butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate is CCC(C)OC(=O)Cc1nc(C2CC2)nn1C.
What is the InChIKey of butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate?
The InChIKey is FXPADIAREJQFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-4-8(2)17-11(16)7-10-13-12(9-5-6-9)14-15(10)3/h8-9H,4-7H2,1-3H3.
What are the key properties of butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate?
butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate has a molecular weight of 237.30 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 2-(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)acetate is sourced from PubChem (CID 167752619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).