C10H18N4 — CID 62720716
N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]propan-1-amine (PubChem CID 62720716) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62720716 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1nc(C2CC2)nn1C |
| InChI | InChI=1S/C10H18N4/c1-3-6-11-7-9-12-10(8-4-5-8)13-14(9)2/h8,11H,3-7H2,1-2H3 |
| InChIKey | RFZXVYUDQHXCDS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|