C18H13N3OS — CID 167754685
2-(5-methyl-1,3-thiazol-2-yl)-6-phenyl-3H-quinazolin-4-one (PubChem CID 167754685) has the molecular formula C18H13N3OS and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-(5-methyl-1,3-thiazol-2-yl)-6-phenyl-3H-quinazolin-4-one.
| Compound Name | 2-(5-methyl-1,3-thiazol-2-yl)-6-phenyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 167754685 |
| Molecular Formula | C18H13N3OS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-(5-methyl-1,3-thiazol-2-yl)-6-phenyl-3H-quinazolin-4-one |
| SMILES | Cc1cnc(-c2nc3ccc(-c4ccccc4)cc3c(=O)[nH]2)s1 |
| InChI | InChI=1S/C18H13N3OS/c1-11-10-19-18(23-11)16-20-15-8-7-13(9-14(15)17(22)21-16)12-5-3-2-4-6-12/h2-10H,1H3,(H,20,21,22) |
| InChIKey | VARCIPXASCZSLS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |