C24H28N2O3 — CID 167755068
N-[(2S)-1-(3-phenylpent-4-enoylamino)propan-2-yl]-2-prop-2-enoxybenzamide (PubChem CID 167755068) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[(2S)-1-(3-phenylpent-4-enoylamino)propan-2-yl]-2-prop-2-enoxybenzamide.
| Compound Name | N-[(2S)-1-(3-phenylpent-4-enoylamino)propan-2-yl]-2-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 167755068 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-[(2S)-1-(3-phenylpent-4-enoylamino)propan-2-yl]-2-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccccc1C(=O)N[C@@H](C)CNC(=O)CC(C=C)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O3/c1-4-15-29-22-14-10-9-13-21(22)24(28)26-18(3)17-25-23(27)16-19(5-2)20-11-7-6-8-12-20/h4-14,18-19H,1-2,15-17H2,3H3,(H,25,27)(H,26,28)/t18-,19?/m0/s1 |
| InChIKey | CEWVMEBMLQVGIS-OYKVQYDMSA-N |
| XLogP | 3.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|