C21H23N5O2 — CID 167755281
2-[4-[2-(4-ethynylanilino)-2-oxoethyl]-1,4-diazepan-1-yl]pyridine-3-carboxamide (PubChem CID 167755281) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-[4-[2-(4-ethynylanilino)-2-oxoethyl]-1,4-diazepan-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-[4-[2-(4-ethynylanilino)-2-oxoethyl]-1,4-diazepan-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167755281 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-[4-[2-(4-ethynylanilino)-2-oxoethyl]-1,4-diazepan-1-yl]pyridine-3-carboxamide |
| SMILES | C#Cc1ccc(NC(=O)CN2CCCN(c3ncccc3C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C21H23N5O2/c1-2-16-6-8-17(9-7-16)24-19(27)15-25-11-4-12-26(14-13-25)21-18(20(22)28)5-3-10-23-21/h1,3,5-10H,4,11-15H2,(H2,22,28)(H,24,27) |
| InChIKey | YXZUTNJKXODOIH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|