C19H21N5O — CID 10337040
2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 10337040) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 10337040 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCN(c3ncccc3C#N)CC2)cc1 |
| InChI | InChI=1S/C19H21N5O/c1-15-4-6-17(7-5-15)22-18(25)14-23-9-11-24(12-10-23)19-16(13-20)3-2-8-21-19/h2-8H,9-12,14H2,1H3,(H,22,25) |
| InChIKey | SGCYAVJKGPJKQH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |