C19H21N5OS — CID 68872911
2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 68872911) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 68872911 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)CN2CCN(c3ncccc3C#N)CC2)c1 |
| InChI | InChI=1S/C19H21N5OS/c1-26-17-6-2-5-16(12-17)22-18(25)14-23-8-10-24(11-9-23)19-15(13-20)4-3-7-21-19/h2-7,12H,8-11,14H2,1H3,(H,22,25) |
| InChIKey | BNXKHZQOUUPVDX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |