C23H25N5OS2 — CID 46393605
N-(3-methylsulfanylphenyl)-2-[3-(4-phenylpiperazin-1-yl)pyrazin-2-yl]sulfanylacetamide (PubChem CID 46393605) has the molecular formula C23H25N5OS2 and a molecular weight of 451.62 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-[3-(4-phenylpiperazin-1-yl)pyrazin-2-yl]sulfanylacetamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-[3-(4-phenylpiperazin-1-yl)pyrazin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46393605 |
| Molecular Formula | C23H25N5OS2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-[3-(4-phenylpiperazin-1-yl)pyrazin-2-yl]sulfanylacetamide |
| SMILES | CSc1cccc(NC(=O)CSc2nccnc2N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H25N5OS2/c1-30-20-9-5-6-18(16-20)26-21(29)17-31-23-22(24-10-11-25-23)28-14-12-27(13-15-28)19-7-3-2-4-8-19/h2-11,16H,12-15,17H2,1H3,(H,26,29) |
| InChIKey | GPOHAFGQHOKUQS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |