C18H20N2O3S2 — CID 4284633
propan-2-yl 2-[2-(3-methylsulfanylanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylate (PubChem CID 4284633) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is propan-2-yl 2-[2-(3-methylsulfanylanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-[2-(3-methylsulfanylanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 4284633 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | propan-2-yl 2-[2-(3-methylsulfanylanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
| SMILES | CSc1cccc(NC(=O)CSc2ncccc2C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-12(2)23-18(22)15-8-5-9-19-17(15)25-11-16(21)20-13-6-4-7-14(10-13)24-3/h4-10,12H,11H2,1-3H3,(H,20,21) |
| InChIKey | AKQWWQBAWPLCPR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |