C15H22N2O3S — CID 5226412
propan-2-yl 2-[2-(butan-2-ylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate (PubChem CID 5226412) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is propan-2-yl 2-[2-(butan-2-ylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-[2-(butan-2-ylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 5226412 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | propan-2-yl 2-[2-(butan-2-ylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
| SMILES | CCC(C)NC(=O)CSc1ncccc1C(=O)OC(C)C |
| InChI | InChI=1S/C15H22N2O3S/c1-5-11(4)17-13(18)9-21-14-12(7-6-8-16-14)15(19)20-10(2)3/h6-8,10-11H,5,9H2,1-4H3,(H,17,18) |
| InChIKey | ZTCWJYZHVCSCMU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |