C23H19N3OS2 — CID 11846555
N-(3-methylsulfanylphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide (PubChem CID 11846555) has the molecular formula C23H19N3OS2 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11846555 |
| Molecular Formula | C23H19N3OS2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide |
| SMILES | CSc1cccc(NC(=O)c2cccnc2SCc2ccnc3ccccc23)c1 |
| InChI | InChI=1S/C23H19N3OS2/c1-28-18-7-4-6-17(14-18)26-22(27)20-9-5-12-25-23(20)29-15-16-11-13-24-21-10-3-2-8-19(16)21/h2-14H,15H2,1H3,(H,26,27) |
| InChIKey | LJGLFZUGYXYYDB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |