C22H17N3O2S — CID 11846554
N-(4-hydroxyphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide (PubChem CID 11846554) has the molecular formula C22H17N3O2S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11846554 |
| Molecular Formula | C22H17N3O2S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)c1cccnc1SCc1ccnc2ccccc12 |
| InChI | InChI=1S/C22H17N3O2S/c26-17-9-7-16(8-10-17)25-21(27)19-5-3-12-24-22(19)28-14-15-11-13-23-20-6-2-1-4-18(15)20/h1-13,26H,14H2,(H,25,27) |
| InChIKey | QGSSDKULSMZQPH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|