C18H17N5O2S — CID 67160270
2-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(4-methoxyphenyl)pyridine-3-carboxamide (PubChem CID 67160270) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(4-methoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 2-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(4-methoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67160270 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(4-methoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccnc2SCc2ccnc(N)n2)cc1 |
| InChI | InChI=1S/C18H17N5O2S/c1-25-14-6-4-12(5-7-14)22-16(24)15-3-2-9-20-17(15)26-11-13-8-10-21-18(19)23-13/h2-10H,11H2,1H3,(H,22,24)(H2,19,21,23) |
| InChIKey | YXKXXNFAUVZAHH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |