C18H17N5OS — CID 67160347
2-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(3-methylphenyl)pyridine-3-carboxamide (PubChem CID 67160347) has the molecular formula C18H17N5OS and a molecular weight of 351.44 g/mol. Its IUPAC name is 2-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(3-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(3-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67160347 |
| Molecular Formula | C18H17N5OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(3-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cccnc2SCc2ccnc(N)n2)c1 |
| InChI | InChI=1S/C18H17N5OS/c1-12-4-2-5-13(10-12)22-16(24)15-6-3-8-20-17(15)25-11-14-7-9-21-18(19)23-14/h2-10H,11H2,1H3,(H,22,24)(H2,19,21,23) |
| InChIKey | IGHWBOZRSOBGCL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |