C21H19N5OS — CID 42600148
4-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(4-methylphenyl)-1H-indole-3-carboxamide (PubChem CID 42600148) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is 4-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(4-methylphenyl)-1H-indole-3-carboxamide.
| Compound Name | 4-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(4-methylphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 42600148 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-[(2-aminopyrimidin-4-yl)methylsulfanyl]-N-(4-methylphenyl)-1H-indole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c[nH]c3cccc(SCc4ccnc(N)n4)c23)cc1 |
| InChI | InChI=1S/C21H19N5OS/c1-13-5-7-14(8-6-13)25-20(27)16-11-24-17-3-2-4-18(19(16)17)28-12-15-9-10-23-21(22)26-15/h2-11,24H,12H2,1H3,(H,25,27)(H2,22,23,26) |
| InChIKey | GTQXVNTXROASDA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |