C27H21N3O2S — CID 42597721
N-(4-phenoxyphenyl)-4-(pyridin-4-ylmethylsulfanyl)-1H-indole-3-carboxamide (PubChem CID 42597721) has the molecular formula C27H21N3O2S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-4-(pyridin-4-ylmethylsulfanyl)-1H-indole-3-carboxamide.
| Compound Name | N-(4-phenoxyphenyl)-4-(pyridin-4-ylmethylsulfanyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 42597721 |
| Molecular Formula | C27H21N3O2S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-(4-phenoxyphenyl)-4-(pyridin-4-ylmethylsulfanyl)-1H-indole-3-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1c[nH]c2cccc(SCc3ccncc3)c12 |
| InChI | InChI=1S/C27H21N3O2S/c31-27(30-20-9-11-22(12-10-20)32-21-5-2-1-3-6-21)23-17-29-24-7-4-8-25(26(23)24)33-18-19-13-15-28-16-14-19/h1-17,29H,18H2,(H,30,31) |
| InChIKey | KFQCAFQRSJRSEX-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |