C24H21N3O2S — CID 11846726
N-(4-hydroxy-3,5-dimethylphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide (PubChem CID 11846726) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-(4-hydroxy-3,5-dimethylphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-(4-hydroxy-3,5-dimethylphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11846726 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-(4-hydroxy-3,5-dimethylphenyl)-2-(quinolin-4-ylmethylsulfanyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cccnc2SCc2ccnc3ccccc23)cc(C)c1O |
| InChI | InChI=1S/C24H21N3O2S/c1-15-12-18(13-16(2)22(15)28)27-23(29)20-7-5-10-26-24(20)30-14-17-9-11-25-21-8-4-3-6-19(17)21/h3-13,28H,14H2,1-2H3,(H,27,29) |
| InChIKey | FKYOFIILAHDNIT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|