C23H25N5OS — CID 71839924
1-(3-methylsulfanylphenyl)-3-[3-(3-piperidin-1-ylpyrazin-2-yl)phenyl]urea (PubChem CID 71839924) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-(3-methylsulfanylphenyl)-3-[3-(3-piperidin-1-ylpyrazin-2-yl)phenyl]urea.
| Compound Name | 1-(3-methylsulfanylphenyl)-3-[3-(3-piperidin-1-ylpyrazin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 71839924 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1-(3-methylsulfanylphenyl)-3-[3-(3-piperidin-1-ylpyrazin-2-yl)phenyl]urea |
| SMILES | CSc1cccc(NC(=O)Nc2cccc(-c3nccnc3N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C23H25N5OS/c1-30-20-10-6-9-19(16-20)27-23(29)26-18-8-5-7-17(15-18)21-22(25-12-11-24-21)28-13-3-2-4-14-28/h5-12,15-16H,2-4,13-14H2,1H3,(H2,26,27,29) |
| InChIKey | ZEHISCDCZSMFNT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |