C22H22ClN5O2 — CID 71840001
1-(5-chloro-2-methoxyphenyl)-3-[3-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]urea (PubChem CID 71840001) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[3-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[3-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 71840001 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[3-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)Nc1cccc(-c2nccnc2N2CCCC2)c1 |
| InChI | InChI=1S/C22H22ClN5O2/c1-30-19-8-7-16(23)14-18(19)27-22(29)26-17-6-4-5-15(13-17)20-21(25-10-9-24-20)28-11-2-3-12-28/h4-10,13-14H,2-3,11-12H2,1H3,(H2,26,27,29) |
| InChIKey | PDIWFMUXBOTTER-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |