C23H25N5O2S — CID 71839883
1-(4-methoxy-2-methylphenyl)-3-[3-(3-thiomorpholin-4-ylpyrazin-2-yl)phenyl]urea (PubChem CID 71839883) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-(4-methoxy-2-methylphenyl)-3-[3-(3-thiomorpholin-4-ylpyrazin-2-yl)phenyl]urea.
| Compound Name | 1-(4-methoxy-2-methylphenyl)-3-[3-(3-thiomorpholin-4-ylpyrazin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 71839883 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-(4-methoxy-2-methylphenyl)-3-[3-(3-thiomorpholin-4-ylpyrazin-2-yl)phenyl]urea |
| SMILES | COc1ccc(NC(=O)Nc2cccc(-c3nccnc3N3CCSCC3)c2)c(C)c1 |
| InChI | InChI=1S/C23H25N5O2S/c1-16-14-19(30-2)6-7-20(16)27-23(29)26-18-5-3-4-17(15-18)21-22(25-9-8-24-21)28-10-12-31-13-11-28/h3-9,14-15H,10-13H2,1-2H3,(H2,26,27,29) |
| InChIKey | UUJGEIKYQIWSEX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |