C24H25N5O3 — CID 71839987
ethyl 4-[[3-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]carbamoylamino]benzoate (PubChem CID 71839987) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is ethyl 4-[[3-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[3-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 71839987 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | ethyl 4-[[3-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2cccc(-c3nccnc3N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C24H25N5O3/c1-2-32-23(30)17-8-10-19(11-9-17)27-24(31)28-20-7-5-6-18(16-20)21-22(26-13-12-25-21)29-14-3-4-15-29/h5-13,16H,2-4,14-15H2,1H3,(H2,27,28,31) |
| InChIKey | GEVYMNPZWBTPOV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |