C21H20ClFN4O2 — CID 53110700
1-(5-chloro-2-methoxyphenyl)-3-(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)urea (PubChem CID 53110700) has the molecular formula C21H20ClFN4O2 and a molecular weight of 414.87 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)urea |
|---|---|
| PubChem CID | 53110700 |
| Molecular Formula | C21H20ClFN4O2 |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)Nc1cc(F)c2nc(N3CCCC3)ccc2c1 |
| InChI | InChI=1S/C21H20ClFN4O2/c1-29-18-6-5-14(22)11-17(18)25-21(28)24-15-10-13-4-7-19(27-8-2-3-9-27)26-20(13)16(23)12-15/h4-7,10-12H,2-3,8-9H2,1H3,(H2,24,25,28) |
| InChIKey | FHAWZGZBZOQAIH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |