C21H19ClF2N4O — CID 53110758
1-(3-chloro-4-fluorophenyl)-3-(8-fluoro-2-piperidin-1-ylquinolin-6-yl)urea (PubChem CID 53110758) has the molecular formula C21H19ClF2N4O and a molecular weight of 416.86 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(8-fluoro-2-piperidin-1-ylquinolin-6-yl)urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(8-fluoro-2-piperidin-1-ylquinolin-6-yl)urea |
|---|---|
| PubChem CID | 53110758 |
| Molecular Formula | C21H19ClF2N4O |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(8-fluoro-2-piperidin-1-ylquinolin-6-yl)urea |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)Nc1cc(F)c2nc(N3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C21H19ClF2N4O/c22-16-11-14(5-6-17(16)23)25-21(29)26-15-10-13-4-7-19(27-20(13)18(24)12-15)28-8-2-1-3-9-28/h4-7,10-12H,1-3,8-9H2,(H2,25,26,29) |
| InChIKey | AXKTVNNGNBENHL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |