C20H25FN4O3 — CID 95086547
ethyl (2S)-2-[(8-fluoro-2-piperidin-1-ylquinolin-6-yl)carbamoylamino]propanoate (PubChem CID 95086547) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is ethyl (2S)-2-[(8-fluoro-2-piperidin-1-ylquinolin-6-yl)carbamoylamino]propanoate.
| Compound Name | ethyl (2S)-2-[(8-fluoro-2-piperidin-1-ylquinolin-6-yl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 95086547 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | ethyl (2S)-2-[(8-fluoro-2-piperidin-1-ylquinolin-6-yl)carbamoylamino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(=O)Nc1cc(F)c2nc(N3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C20H25FN4O3/c1-3-28-19(26)13(2)22-20(27)23-15-11-14-7-8-17(24-18(14)16(21)12-15)25-9-5-4-6-10-25/h7-8,11-13H,3-6,9-10H2,1-2H3,(H2,22,23,27)/t13-/m0/s1 |
| InChIKey | HLGWNKADEIBVIT-ZDUSSCGKSA-N |
| XLogP | 3.44 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |