C25H27FN4O3 — CID 95086537
ethyl (3R)-3-[(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)carbamoylamino]-3-phenylpropanoate (PubChem CID 95086537) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is ethyl (3R)-3-[(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)carbamoylamino]-3-phenylpropanoate.
| Compound Name | ethyl (3R)-3-[(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 95086537 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | ethyl (3R)-3-[(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)carbamoylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C[C@@H](NC(=O)Nc1cc(F)c2nc(N3CCCC3)ccc2c1)c1ccccc1 |
| InChI | InChI=1S/C25H27FN4O3/c1-2-33-23(31)16-21(17-8-4-3-5-9-17)28-25(32)27-19-14-18-10-11-22(30-12-6-7-13-30)29-24(18)20(26)15-19/h3-5,8-11,14-15,21H,2,6-7,12-13,16H2,1H3,(H2,27,28,32)/t21-/m1/s1 |
| InChIKey | PDOALQHBYTZVMX-OAQYLSRUSA-N |
| XLogP | 4.79 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |